C22H22O7 — CID 70240436
[(4aR,5R,6R,7R)-7-acetyloxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] furan-2-carboxylate (PubChem CID 70240436) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is [(4aR,5R,6R,7R)-7-acetyloxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] furan-2-carboxylate.
| Compound Name | [(4aR,5R,6R,7R)-7-acetyloxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 70240436 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [(4aR,5R,6R,7R)-7-acetyloxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] furan-2-carboxylate |
| SMILES | CC(=O)O[C@@H]1C=C2C=C3OC(=O)C(C)=C3C[C@]2(C)[C@@H](C)[C@H]1OC(=O)c1ccco1 |
| InChI | InChI=1S/C22H22O7/c1-11-15-10-22(4)12(2)19(29-21(25)16-6-5-7-26-16)18(27-13(3)23)9-14(22)8-17(15)28-20(11)24/h5-9,12,18-19H,10H2,1-4H3/t12-,18+,19+,22+/m0/s1 |
| InChIKey | SJWZOVOHVVTBDO-VQQXHSIVSA-N |
| XLogP | 3.48 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|