C16H20O3 — CID 70240472
6-hydroxy-3,4a,5,9-tetramethyl-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-2-one (PubChem CID 70240472) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 6-hydroxy-3,4a,5,9-tetramethyl-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | 6-hydroxy-3,4a,5,9-tetramethyl-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 70240472 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 6-hydroxy-3,4a,5,9-tetramethyl-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=C2CC3(C)C(=CCC(O)C3C)C(C)=C2OC1=O |
| InChI | InChI=1S/C16H20O3/c1-8-11-7-16(4)10(3)13(17)6-5-12(16)9(2)14(11)19-15(8)18/h5,10,13,17H,6-7H2,1-4H3 |
| InChIKey | MOQPBOKELXCKON-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |