C10H17F2NO — CID 70240603
2-[(3S)-2,3-dimethyl-2,6-dihydropyran-3-yl]-3,3-difluoropropan-1-amine (PubChem CID 70240603) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is 2-[(3S)-2,3-dimethyl-2,6-dihydropyran-3-yl]-3,3-difluoropropan-1-amine.
| Compound Name | 2-[(3S)-2,3-dimethyl-2,6-dihydropyran-3-yl]-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 70240603 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-[(3S)-2,3-dimethyl-2,6-dihydropyran-3-yl]-3,3-difluoropropan-1-amine |
| SMILES | CC1OCC=C[C@@]1(C)C(CN)C(F)F |
| InChI | InChI=1S/C10H17F2NO/c1-7-10(2,4-3-5-14-7)8(6-13)9(11)12/h3-4,7-9H,5-6,13H2,1-2H3/t7?,8?,10-/m1/s1 |
| InChIKey | BKLUKCLEERSEMU-SFVIPPHHSA-N |
| XLogP | 1.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|