C20H26O4 — CID 70240708
[(4aR,5R,6S)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] 3-methylbutanoate (PubChem CID 70240708) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is [(4aR,5R,6S)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] 3-methylbutanoate.
| Compound Name | [(4aR,5R,6S)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 70240708 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [(4aR,5R,6S)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] 3-methylbutanoate |
| SMILES | CC1=C2C[C@@]3(C)C(=CC[C@H](OC(=O)CC(C)C)[C@@H]3C)C=C2OC1=O |
| InChI | InChI=1S/C20H26O4/c1-11(2)8-18(21)23-16-7-6-14-9-17-15(12(3)19(22)24-17)10-20(14,5)13(16)4/h6,9,11,13,16H,7-8,10H2,1-5H3/t13-,16-,20+/m0/s1 |
| InChIKey | OIJILRADBLGKJR-ZSOFBXJNSA-N |
| XLogP | 4.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |