C19H23N3O2 — CID 70241406
2-[2-[3-(2-bicyclo[2.2.1]hept-5-enyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N,N-dimethylethanamine (PubChem CID 70241406) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[2-[3-(2-bicyclo[2.2.1]hept-5-enyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[2-[3-(2-bicyclo[2.2.1]hept-5-enyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 70241406 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[2-[3-(2-bicyclo[2.2.1]hept-5-enyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccccc1-c1nc(C2CC3C=CC2C3)no1 |
| InChI | InChI=1S/C19H23N3O2/c1-22(2)9-10-23-17-6-4-3-5-15(17)19-20-18(21-24-19)16-12-13-7-8-14(16)11-13/h3-8,13-14,16H,9-12H2,1-2H3 |
| InChIKey | QXUBHPCRSNXILB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|