C17H30F4N2O2 — CID 70241488
2-fluoro-1,3-dihexyl-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate (PubChem CID 70241488) has the molecular formula C17H30F4N2O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-fluoro-1,3-dihexyl-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 2-fluoro-1,3-dihexyl-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70241488 |
| Molecular Formula | C17H30F4N2O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 2-fluoro-1,3-dihexyl-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate |
| SMILES | CCCCCCN1CC[N+](CCCCCC)=C1F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C15H30FN2.C2HF3O2/c1-3-5-7-9-11-17-13-14-18(15(17)16)12-10-8-6-4-2;3-2(4,5)1(6)7/h3-14H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | UNRBXMORHSEBKB-UHFFFAOYSA-M |
| XLogP | 3.10 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|