C11H18F4N2O2 — CID 70243175
2-fluoro-1,3-di(propan-2-yl)-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate (PubChem CID 70243175) has the molecular formula C11H18F4N2O2 and a molecular weight of 286.27 g/mol. Its IUPAC name is 2-fluoro-1,3-di(propan-2-yl)-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 2-fluoro-1,3-di(propan-2-yl)-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70243175 |
| Molecular Formula | C11H18F4N2O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-fluoro-1,3-di(propan-2-yl)-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate |
| SMILES | CC(C)N1CC[N+](C(C)C)=C1F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C9H18FN2.C2HF3O2/c1-7(2)11-5-6-12(8(3)4)9(11)10;3-2(4,5)1(6)7/h7-8H,5-6H2,1-4H3;(H,6,7)/q+1;/p-1 |
| InChIKey | PBIFRKPXOIPPDY-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|