About 4-methyl-[1]benzofuro[2,3-b]pyridine
4-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 70243457) has the molecular formula C12H9NO
and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-methyl-[1]benzofuro[2,3-b]pyridine.
Molecular Properties
| Compound Name | 4-methyl-[1]benzofuro[2,3-b]pyridine |
| PubChem CID | 70243457 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 4-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccnc2oc3ccccc3c12 |
| InChI | InChI=1S/C12H9NO/c1-8-6-7-13-12-11(8)9-4-2-3-5-10(9)14-12/h2-7H,1H3 |
| InChIKey | VSUFJQOLWPKCOX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-[1]benzofuro[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-[1]benzofuro[2,3-b]pyridine?
The IUPAC name of 4-methyl-[1]benzofuro[2,3-b]pyridine (CID 70243457) is 4-methyl-[1]benzofuro[2,3-b]pyridine.
What is the SMILES notation for 4-methyl-[1]benzofuro[2,3-b]pyridine?
The canonical SMILES for 4-methyl-[1]benzofuro[2,3-b]pyridine is Cc1ccnc2oc3ccccc3c12.
What is the InChIKey of 4-methyl-[1]benzofuro[2,3-b]pyridine?
The InChIKey is VSUFJQOLWPKCOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO/c1-8-6-7-13-12-11(8)9-4-2-3-5-10(9)14-12/h2-7H,1H3.
What are the key properties of 4-methyl-[1]benzofuro[2,3-b]pyridine?
4-methyl-[1]benzofuro[2,3-b]pyridine has a molecular weight of 183.21 g/mol, XLogP of 3.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-[1]benzofuro[2,3-b]pyridine is sourced from PubChem (CID 70243457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).