C28H26F3N3O6 — CID 70244448
prop-2-enyl 3-(6-amino-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;2,2,2-trifluoroacetic acid (PubChem CID 70244448) has the molecular formula C28H26F3N3O6 and a molecular weight of 557.53 g/mol. Its IUPAC name is prop-2-enyl 3-(6-amino-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | prop-2-enyl 3-(6-amino-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70244448 |
| Molecular Formula | C28H26F3N3O6 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | prop-2-enyl 3-(6-amino-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOC(=O)C(Cc1ccc(N)nc1)NC(=O)OCC1c2ccccc2-c2ccccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H25N3O4.C2HF3O2/c1-2-13-32-25(30)23(14-17-11-12-24(27)28-15-17)29-26(31)33-16-22-20-9-5-3-7-18(20)19-8-4-6-10-21(19)22;3-2(4,5)1(6)7/h2-12,15,22-23H,1,13-14,16H2,(H2,27,28)(H,29,31);(H,6,7) |
| InChIKey | WLJDJQGMEOQHNL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|