About (E)-but-2-enoic acid;N-ethylcyclohexanamine
(E)-but-2-enoic acid;N-ethylcyclohexanamine (PubChem CID 70244613) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is (E)-but-2-enoic acid;N-ethylcyclohexanamine.
Molecular Properties
| Compound Name | (E)-but-2-enoic acid;N-ethylcyclohexanamine |
| PubChem CID | 70244613 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (E)-but-2-enoic acid;N-ethylcyclohexanamine |
| SMILES | C/C=C/C(=O)O.CCNC1CCCCC1 |
| InChI | InChI=1S/C8H17N.C4H6O2/c1-2-9-8-6-4-3-5-7-8;1-2-3-4(5)6/h8-9H,2-7H2,1H3;2-3H,1H3,(H,5,6)/b;3-2+ |
| InChIKey | FYLKSWYMVKEKNY-ZPYUXNTASA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enoic acid;N-ethylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enoic acid;N-ethylcyclohexanamine?
The IUPAC name of (E)-but-2-enoic acid;N-ethylcyclohexanamine (CID 70244613) is (E)-but-2-enoic acid;N-ethylcyclohexanamine.
What is the SMILES notation for (E)-but-2-enoic acid;N-ethylcyclohexanamine?
The canonical SMILES for (E)-but-2-enoic acid;N-ethylcyclohexanamine is C/C=C/C(=O)O.CCNC1CCCCC1.
What is the InChIKey of (E)-but-2-enoic acid;N-ethylcyclohexanamine?
The InChIKey is FYLKSWYMVKEKNY-ZPYUXNTASA-N. The full InChI is InChI=1S/C8H17N.C4H6O2/c1-2-9-8-6-4-3-5-7-8;1-2-3-4(5)6/h8-9H,2-7H2,1H3;2-3H,1H3,(H,5,6)/b;3-2+.
What are the key properties of (E)-but-2-enoic acid;N-ethylcyclohexanamine?
(E)-but-2-enoic acid;N-ethylcyclohexanamine has a molecular weight of 213.32 g/mol, XLogP of 2.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enoic acid;N-ethylcyclohexanamine is sourced from PubChem (CID 70244613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).