C27H28Cl2N6O4 — CID 70244665
3-(6-acetamido-3-pyridinyl)-N-[2-[3-[[2-amino-3-(methylamino)phenoxy]methyl]-2,4-dichloro-N-methylanilino]-2-oxoethyl]prop-2-enamide (PubChem CID 70244665) has the molecular formula C27H28Cl2N6O4 and a molecular weight of 571.47 g/mol. Its IUPAC name is 3-(6-acetamido-3-pyridinyl)-N-[2-[3-[[2-amino-3-(methylamino)phenoxy]methyl]-2,4-dichloro-N-methylanilino]-2-oxoethyl]prop-2-enamide.
| Compound Name | 3-(6-acetamido-3-pyridinyl)-N-[2-[3-[[2-amino-3-(methylamino)phenoxy]methyl]-2,4-dichloro-N-methylanilino]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 70244665 |
| Molecular Formula | C27H28Cl2N6O4 |
| Molecular Weight | 571.47 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 3-(6-acetamido-3-pyridinyl)-N-[2-[3-[[2-amino-3-(methylamino)phenoxy]methyl]-2,4-dichloro-N-methylanilino]-2-oxoethyl]prop-2-enamide |
| SMILES | CNc1cccc(OCc2c(Cl)ccc(N(C)C(=O)CNC(=O)C=Cc3ccc(NC(C)=O)nc3)c2Cl)c1N |
| InChI | InChI=1S/C27H28Cl2N6O4/c1-16(36)34-23-11-7-17(13-32-23)8-12-24(37)33-14-25(38)35(3)21-10-9-19(28)18(26(21)29)15-39-22-6-4-5-20(31-2)27(22)30/h4-13,31H,14-15,30H2,1-3H3,(H,33,37)(H,32,34,36) |
| InChIKey | VNUUMQRDQRMQIJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|