C11H14N2O4 — CID 70244670
3-prop-2-enylpyrrolidine-2,5-dione;pyrrolidine-2,5-dione (PubChem CID 70244670) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-prop-2-enylpyrrolidine-2,5-dione;pyrrolidine-2,5-dione.
| Compound Name | 3-prop-2-enylpyrrolidine-2,5-dione;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70244670 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-prop-2-enylpyrrolidine-2,5-dione;pyrrolidine-2,5-dione |
| SMILES | C=CCC1CC(=O)NC1=O.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C7H9NO2.C4H5NO2/c1-2-3-5-4-6(9)8-7(5)10;6-3-1-2-4(7)5-3/h2,5H,1,3-4H2,(H,8,9,10);1-2H2,(H,5,6,7) |
| InChIKey | CWZBRLHMSPBERE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|