C42H47NO6 — CID 70244685
ethyl 2-[benzyl-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetyl]amino]-4,6-bis(phenylmethoxy)benzoate (PubChem CID 70244685) has the molecular formula C42H47NO6 and a molecular weight of 661.84 g/mol. Its IUPAC name is ethyl 2-[benzyl-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetyl]amino]-4,6-bis(phenylmethoxy)benzoate.
| Compound Name | ethyl 2-[benzyl-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetyl]amino]-4,6-bis(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 70244685 |
| Molecular Formula | C42H47NO6 |
| Molecular Weight | 661.84 g/mol |
| Exact Mass | 661.34 |
| IUPAC Name | ethyl 2-[benzyl-[2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetyl]amino]-4,6-bis(phenylmethoxy)benzoate |
| SMILES | CCOC(=O)c1c(OCc2ccccc2)cc(OCc2ccccc2)cc1N(Cc1ccccc1)C(=O)COC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C42H47NO6/c1-5-47-42(45)41-38(26-37(48-29-35-20-11-7-12-21-35)27-39(41)49-30-36-22-13-8-14-23-36)43(28-34-18-9-6-10-19-34)40(44)31-46-25-24-33(4)17-15-16-32(2)3/h6-14,16,18-24,26-27H,5,15,17,25,28-31H2,1-4H3/b33-24+ |
| InChIKey | RMYXSNQMEGFABT-IWBSIUBASA-N |
| XLogP | 9.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.84 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|