About 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide
7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide (PubChem CID 70245231) has the molecular formula C16H13NO4S2
and a molecular weight of 347.42 g/mol. Its IUPAC name is 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide.
Molecular Properties
| Compound Name | 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide |
| PubChem CID | 70245231 |
| Molecular Formula | C16H13NO4S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide |
| SMILES | NS(=O)(=O)c1c(Cc2ccccc2)sc2ccc3c(c12)OCO3 |
| InChI | InChI=1S/C16H13NO4S2/c17-23(18,19)16-13(8-10-4-2-1-3-5-10)22-12-7-6-11-15(14(12)16)21-9-20-11/h1-7H,8-9H2,(H2,17,18,19) |
| InChIKey | NFCOVQSMPVCFQW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide?
The IUPAC name of 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide (CID 70245231) is 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide.
What is the SMILES notation for 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide?
The canonical SMILES for 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide is NS(=O)(=O)c1c(Cc2ccccc2)sc2ccc3c(c12)OCO3.
What is the InChIKey of 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide?
The InChIKey is NFCOVQSMPVCFQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO4S2/c17-23(18,19)16-13(8-10-4-2-1-3-5-10)22-12-7-6-11-15(14(12)16)21-9-20-11/h1-7H,8-9H2,(H2,17,18,19).
What are the key properties of 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide?
7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide has a molecular weight of 347.42 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzylthieno[2,3-g][1,3]benzodioxole-8-sulfonamide is sourced from PubChem (CID 70245231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).