About 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione
2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione (PubChem CID 70245643) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione.
Molecular Properties
| Compound Name | 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione |
| PubChem CID | 70245643 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione |
| SMILES | Cc1cc(=O)n2c(n1)C(=O)CCC2 |
| InChI | InChI=1S/C9H10N2O2/c1-6-5-8(13)11-4-2-3-7(12)9(11)10-6/h5H,2-4H2,1H3 |
| InChIKey | GGWXSOUCLDPUHA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione?
The IUPAC name of 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione (CID 70245643) is 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione.
What is the SMILES notation for 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione?
The canonical SMILES for 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione is Cc1cc(=O)n2c(n1)C(=O)CCC2.
What is the InChIKey of 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione?
The InChIKey is GGWXSOUCLDPUHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-6-5-8(13)11-4-2-3-7(12)9(11)10-6/h5H,2-4H2,1H3.
What are the key properties of 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione?
2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione has a molecular weight of 178.19 g/mol, XLogP of 0.53, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione is sourced from PubChem (CID 70245643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).