C19H20ClN3O2 — CID 70245911
3-[(7S,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-yl]-2-(5-chloro-2-pyridinyl)benzoic acid (PubChem CID 70245911) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 3-[(7S,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-yl]-2-(5-chloro-2-pyridinyl)benzoic acid.
| Compound Name | 3-[(7S,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-yl]-2-(5-chloro-2-pyridinyl)benzoic acid |
|---|---|
| PubChem CID | 70245911 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 3-[(7S,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-yl]-2-(5-chloro-2-pyridinyl)benzoic acid |
| SMILES | O=C(O)c1cccc([C@@H]2C[C@H]3CNCCN3C2)c1-c1ccc(Cl)cn1 |
| InChI | InChI=1S/C19H20ClN3O2/c20-13-4-5-17(22-9-13)18-15(2-1-3-16(18)19(24)25)12-8-14-10-21-6-7-23(14)11-12/h1-5,9,12,14,21H,6-8,10-11H2,(H,24,25)/t12-,14+/m1/s1 |
| InChIKey | RUSFBGPXJWMSLY-OCCSQVGLSA-N |
| XLogP | 2.86 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |