About bis(3-methylphenyl) pentanedioate
bis(3-methylphenyl) pentanedioate (PubChem CID 70246036) has the molecular formula C19H20O4
and a molecular weight of 312.37 g/mol. Its IUPAC name is bis(3-methylphenyl) pentanedioate.
Molecular Properties
| Compound Name | bis(3-methylphenyl) pentanedioate |
| PubChem CID | 70246036 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | bis(3-methylphenyl) pentanedioate |
| SMILES | Cc1cccc(OC(=O)CCCC(=O)Oc2cccc(C)c2)c1 |
| InChI | InChI=1S/C19H20O4/c1-14-6-3-8-16(12-14)22-18(20)10-5-11-19(21)23-17-9-4-7-15(2)13-17/h3-4,6-9,12-13H,5,10-11H2,1-2H3 |
| InChIKey | JQMOSWULUPHZLC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(3-methylphenyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methylphenyl) pentanedioate?
The IUPAC name of bis(3-methylphenyl) pentanedioate (CID 70246036) is bis(3-methylphenyl) pentanedioate.
What is the SMILES notation for bis(3-methylphenyl) pentanedioate?
The canonical SMILES for bis(3-methylphenyl) pentanedioate is Cc1cccc(OC(=O)CCCC(=O)Oc2cccc(C)c2)c1.
What is the InChIKey of bis(3-methylphenyl) pentanedioate?
The InChIKey is JQMOSWULUPHZLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O4/c1-14-6-3-8-16(12-14)22-18(20)10-5-11-19(21)23-17-9-4-7-15(2)13-17/h3-4,6-9,12-13H,5,10-11H2,1-2H3.
What are the key properties of bis(3-methylphenyl) pentanedioate?
bis(3-methylphenyl) pentanedioate has a molecular weight of 312.37 g/mol, XLogP of 3.98, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methylphenyl) pentanedioate is sourced from PubChem (CID 70246036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).