About [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate
[(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate (PubChem CID 7024641) has the molecular formula C18H16N2O5
and a molecular weight of 340.34 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate.
Molecular Properties
| Compound Name | [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate |
| PubChem CID | 7024641 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate |
| SMILES | CC[C@H](C)OC(=O)/C(C#N)=C/c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H16N2O5/c1-3-12(2)24-18(21)13(11-19)10-14-8-9-17(25-14)15-6-4-5-7-16(15)20(22)23/h4-10,12H,3H2,1-2H3/b13-10+/t12-/m0/s1 |
| InChIKey | UXJNYVPLBNNEQM-CVCOIXHCSA-N |
| XLogP | 4.10 |
| TPSA | 106.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate?
The IUPAC name of [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate (CID 7024641) is [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate.
What is the SMILES notation for [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate?
The canonical SMILES for [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate is CC[C@H](C)OC(=O)/C(C#N)=C/c1ccc(-c2ccccc2[N+](=O)[O-])o1.
What is the InChIKey of [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate?
The InChIKey is UXJNYVPLBNNEQM-CVCOIXHCSA-N. The full InChI is InChI=1S/C18H16N2O5/c1-3-12(2)24-18(21)13(11-19)10-14-8-9-17(25-14)15-6-4-5-7-16(15)20(22)23/h4-10,12H,3H2,1-2H3/b13-10+/t12-/m0/s1.
What are the key properties of [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate?
[(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate has a molecular weight of 340.34 g/mol, XLogP of 4.10, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-butan-2-yl] (E)-2-cyano-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoate is sourced from PubChem (CID 7024641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).