C22H24ClFN6 — CID 70246687
6-(2-chloro-6-fluorophenyl)-8-N-[4-(dimethylamino)butyl]imidazo[1,5-a]quinoxaline-4,8-diamine (PubChem CID 70246687) has the molecular formula C22H24ClFN6 and a molecular weight of 426.93 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-8-N-[4-(dimethylamino)butyl]imidazo[1,5-a]quinoxaline-4,8-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-8-N-[4-(dimethylamino)butyl]imidazo[1,5-a]quinoxaline-4,8-diamine |
|---|---|
| PubChem CID | 70246687 |
| Molecular Formula | C22H24ClFN6 |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-8-N-[4-(dimethylamino)butyl]imidazo[1,5-a]quinoxaline-4,8-diamine |
| SMILES | CN(C)CCCCNc1cc(-c2c(F)cccc2Cl)c2nc(N)c3cncn3c2c1 |
| InChI | InChI=1S/C22H24ClFN6/c1-29(2)9-4-3-8-27-14-10-15(20-16(23)6-5-7-17(20)24)21-18(11-14)30-13-26-12-19(30)22(25)28-21/h5-7,10-13,27H,3-4,8-9H2,1-2H3,(H2,25,28) |
| InChIKey | QXIYPIPCSSKVBN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|