C32H34N2O8 — CID 70246786
methyl 4-[[(5R,6R)-5,6-diacetyloxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4(9),10,14,16,18,20-octaen-11-yl]amino]butanoate (PubChem CID 70246786) has the molecular formula C32H34N2O8 and a molecular weight of 574.63 g/mol. Its IUPAC name is methyl 4-[[(5R,6R)-5,6-diacetyloxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4(9),10,14,16,18,20-octaen-11-yl]amino]butanoate.
| Compound Name | methyl 4-[[(5R,6R)-5,6-diacetyloxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4(9),10,14,16,18,20-octaen-11-yl]amino]butanoate |
|---|---|
| PubChem CID | 70246786 |
| Molecular Formula | C32H34N2O8 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | methyl 4-[[(5R,6R)-5,6-diacetyloxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4(9),10,14,16,18,20-octaen-11-yl]amino]butanoate |
| SMILES | COC(=O)CCCNc1cc2c(c3c1c(=O)c1cc4ccccc4cc1n3C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)C(C)(C)O2 |
| InChI | InChI=1S/C32H34N2O8/c1-17(35)40-30-27-24(42-32(3,4)31(30)41-18(2)36)16-22(33-13-9-12-25(37)39-6)26-28(27)34(5)23-15-20-11-8-7-10-19(20)14-21(23)29(26)38/h7-8,10-11,14-16,30-31,33H,9,12-13H2,1-6H3/t30-,31-/m1/s1 |
| InChIKey | WLNZWERQQOOZGY-FIRIVFDPSA-N |
| XLogP | 4.92 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|