About sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane
sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane (PubChem CID 70246895) has the molecular formula C12H9NaO3S2
and a molecular weight of 288.32 g/mol. Its IUPAC name is sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane.
Molecular Properties
| Compound Name | sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane |
| PubChem CID | 70246895 |
| Molecular Formula | C12H9NaO3S2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane |
| SMILES | O=S([O-])(=S)Oc1ccc(-c2ccccc2)cc1.[Na+] |
| InChI | InChI=1S/C12H10O3S2.Na/c13-17(14,16)15-12-8-6-11(7-9-12)10-4-2-1-3-5-10;/h1-9H,(H,13,14,16);/q;+1/p-1 |
| InChIKey | FWTBDNHEEULURY-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane?
The IUPAC name of sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane (CID 70246895) is sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane.
What is the SMILES notation for sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane?
The canonical SMILES for sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane is O=S([O-])(=S)Oc1ccc(-c2ccccc2)cc1.[Na+].
What is the InChIKey of sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane?
The InChIKey is FWTBDNHEEULURY-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10O3S2.Na/c13-17(14,16)15-12-8-6-11(7-9-12)10-4-2-1-3-5-10;/h1-9H,(H,13,14,16);/q;+1/p-1.
What are the key properties of sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane?
sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane has a molecular weight of 288.32 g/mol, XLogP of -0.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium oxido-oxo-(4-phenylphenoxy)-sulfanylidene-λ6-sulfane is sourced from PubChem (CID 70246895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).