C23H23N5O2S — CID 70247034
5-(benzenesulfonyl)-11-benzyl-N-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine (PubChem CID 70247034) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-11-benzyl-N-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine.
| Compound Name | 5-(benzenesulfonyl)-11-benzyl-N-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 70247034 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 5-(benzenesulfonyl)-11-benzyl-N-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-amine |
| SMILES | CNc1nn2c3c(cnc2c1S(=O)(=O)c1ccccc1)CN(Cc1ccccc1)CC3 |
| InChI | InChI=1S/C23H23N5O2S/c1-24-22-21(31(29,30)19-10-6-3-7-11-19)23-25-14-18-16-27(13-12-20(18)28(23)26-22)15-17-8-4-2-5-9-17/h2-11,14H,12-13,15-16H2,1H3,(H,24,26) |
| InChIKey | CKEALDVHEFDMHC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |