C29H30Cl2N4OS — CID 70247980
N-[[2-[(4-phenylpiperidin-1-yl)methyl]phenyl]methyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride (PubChem CID 70247980) has the molecular formula C29H30Cl2N4OS and a molecular weight of 553.56 g/mol. Its IUPAC name is N-[[2-[(4-phenylpiperidin-1-yl)methyl]phenyl]methyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride.
| Compound Name | N-[[2-[(4-phenylpiperidin-1-yl)methyl]phenyl]methyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 70247980 |
| Molecular Formula | C29H30Cl2N4OS |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | N-[[2-[(4-phenylpiperidin-1-yl)methyl]phenyl]methyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCc1ccccc1CN1CCC(c2ccccc2)CC1)C1=Cc2cnc3cccc(n23)S1 |
| InChI | InChI=1S/C29H28N4OS.2ClH/c34-29(26-17-25-19-30-27-11-6-12-28(35-26)33(25)27)31-18-23-9-4-5-10-24(23)20-32-15-13-22(14-16-32)21-7-2-1-3-8-21;;/h1-12,17,19,22H,13-16,18,20H2,(H,31,34);2*1H |
| InChIKey | GPUXQTCECOIRBH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |