C20H22F2N4O — CID 70248253
4-[5-[2-(2,6-difluorophenoxy)propan-2-yl]-4-propan-2-yl-1,2,4-triazol-3-yl]aniline (PubChem CID 70248253) has the molecular formula C20H22F2N4O and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-[5-[2-(2,6-difluorophenoxy)propan-2-yl]-4-propan-2-yl-1,2,4-triazol-3-yl]aniline.
| Compound Name | 4-[5-[2-(2,6-difluorophenoxy)propan-2-yl]-4-propan-2-yl-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 70248253 |
| Molecular Formula | C20H22F2N4O |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-[5-[2-(2,6-difluorophenoxy)propan-2-yl]-4-propan-2-yl-1,2,4-triazol-3-yl]aniline |
| SMILES | CC(C)n1c(-c2ccc(N)cc2)nnc1C(C)(C)Oc1c(F)cccc1F |
| InChI | InChI=1S/C20H22F2N4O/c1-12(2)26-18(13-8-10-14(23)11-9-13)24-25-19(26)20(3,4)27-17-15(21)6-5-7-16(17)22/h5-12H,23H2,1-4H3 |
| InChIKey | NXVCLRSSFPXHGE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|