About 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide
3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide (PubChem CID 70248516) has the molecular formula C20H23BrN2O
and a molecular weight of 387.32 g/mol. Its IUPAC name is 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide.
Molecular Properties
| Compound Name | 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide |
| PubChem CID | 70248516 |
| Molecular Formula | C20H23BrN2O |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc3c(c2)C(C)N(C)CC3)cc1Br |
| InChI | InChI=1S/C20H23BrN2O/c1-4-14-5-6-16(11-19(14)21)20(24)22-17-8-7-15-9-10-23(3)13(2)18(15)12-17/h5-8,11-13H,4,9-10H2,1-3H3,(H,22,24) |
| InChIKey | QPDMEVCCQAQDQE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide?
The IUPAC name of 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide (CID 70248516) is 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide.
What is the SMILES notation for 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide?
The canonical SMILES for 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide is CCc1ccc(C(=O)Nc2ccc3c(c2)C(C)N(C)CC3)cc1Br.
What is the InChIKey of 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide?
The InChIKey is QPDMEVCCQAQDQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23BrN2O/c1-4-14-5-6-16(11-19(14)21)20(24)22-17-8-7-15-9-10-23(3)13(2)18(15)12-17/h5-8,11-13H,4,9-10H2,1-3H3,(H,22,24).
What are the key properties of 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide?
3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide has a molecular weight of 387.32 g/mol, XLogP of 4.81, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(1,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-ethylbenzamide is sourced from PubChem (CID 70248516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).