About 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene
2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene (PubChem CID 70248681) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene |
| PubChem CID | 70248681 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene |
| SMILES | COC[C@H](C)C/C=C/C1=CC(C)CC=C1 |
| InChI | InChI=1S/C14H22O/c1-12-6-4-8-14(10-12)9-5-7-13(2)11-15-3/h4-5,8-10,12-13H,6-7,11H2,1-3H3/b9-5+/t12?,13-/m1/s1 |
| InChIKey | UOSZLANRTQGRGV-ONTKSJMPSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene?
The IUPAC name of 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene (CID 70248681) is 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene.
What is the SMILES notation for 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene?
The canonical SMILES for 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene is COC[C@H](C)C/C=C/C1=CC(C)CC=C1.
What is the InChIKey of 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene?
The InChIKey is UOSZLANRTQGRGV-ONTKSJMPSA-N. The full InChI is InChI=1S/C14H22O/c1-12-6-4-8-14(10-12)9-5-7-13(2)11-15-3/h4-5,8-10,12-13H,6-7,11H2,1-3H3/b9-5+/t12?,13-/m1/s1.
What are the key properties of 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene?
2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene has a molecular weight of 206.33 g/mol, XLogP of 3.74, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E,4R)-5-methoxy-4-methylpent-1-enyl]-6-methylcyclohexa-1,3-diene is sourced from PubChem (CID 70248681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).