About bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate
bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate (PubChem CID 70248831) has the molecular formula C20H28N2O4
and a molecular weight of 360.45 g/mol. Its IUPAC name is bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate.
Molecular Properties
| Compound Name | bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate |
| PubChem CID | 70248831 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate |
| SMILES | CN1[C@@H]2CC[C@H]1CC(OC(=O)C#CC(=O)OC1C[C@H]3CC[C@@H](C1)N3C)C2 |
| InChI | InChI=1S/C20H28N2O4/c1-21-13-3-4-14(21)10-17(9-13)25-19(23)7-8-20(24)26-18-11-15-5-6-16(12-18)22(15)2/h13-18H,3-6,9-12H2,1-2H3/t13-,14+,15-,16+,17?,18? |
| InChIKey | IICIJALJUFYBRV-OLQSNFDLSA-N |
| XLogP | 1.33 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate?
The IUPAC name of bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate (CID 70248831) is bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate.
What is the SMILES notation for bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate?
The canonical SMILES for bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate is CN1[C@@H]2CC[C@H]1CC(OC(=O)C#CC(=O)OC1C[C@H]3CC[C@@H](C1)N3C)C2.
What is the InChIKey of bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate?
The InChIKey is IICIJALJUFYBRV-OLQSNFDLSA-N. The full InChI is InChI=1S/C20H28N2O4/c1-21-13-3-4-14(21)10-17(9-13)25-19(23)7-8-20(24)26-18-11-15-5-6-16(12-18)22(15)2/h13-18H,3-6,9-12H2,1-2H3/t13-,14+,15-,16+,17?,18?.
What are the key properties of bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate?
bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate has a molecular weight of 360.45 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] but-2-ynedioate is sourced from PubChem (CID 70248831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).