About 2-aminonaphthalene-1,8-dicarboxamide
2-aminonaphthalene-1,8-dicarboxamide (PubChem CID 70248855) has the molecular formula C12H11N3O2
and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-aminonaphthalene-1,8-dicarboxamide.
Molecular Properties
| Compound Name | 2-aminonaphthalene-1,8-dicarboxamide |
| PubChem CID | 70248855 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-aminonaphthalene-1,8-dicarboxamide |
| SMILES | NC(=O)c1cccc2ccc(N)c(C(N)=O)c12 |
| InChI | InChI=1S/C12H11N3O2/c13-8-5-4-6-2-1-3-7(11(14)16)9(6)10(8)12(15)17/h1-5H,13H2,(H2,14,16)(H2,15,17) |
| InChIKey | ACCZYPOPPFLQDR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminonaphthalene-1,8-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminonaphthalene-1,8-dicarboxamide?
The IUPAC name of 2-aminonaphthalene-1,8-dicarboxamide (CID 70248855) is 2-aminonaphthalene-1,8-dicarboxamide.
What is the SMILES notation for 2-aminonaphthalene-1,8-dicarboxamide?
The canonical SMILES for 2-aminonaphthalene-1,8-dicarboxamide is NC(=O)c1cccc2ccc(N)c(C(N)=O)c12.
What is the InChIKey of 2-aminonaphthalene-1,8-dicarboxamide?
The InChIKey is ACCZYPOPPFLQDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c13-8-5-4-6-2-1-3-7(11(14)16)9(6)10(8)12(15)17/h1-5H,13H2,(H2,14,16)(H2,15,17).
What are the key properties of 2-aminonaphthalene-1,8-dicarboxamide?
2-aminonaphthalene-1,8-dicarboxamide has a molecular weight of 229.24 g/mol, XLogP of 0.62, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminonaphthalene-1,8-dicarboxamide is sourced from PubChem (CID 70248855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).