About 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride
5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride (PubChem CID 70249249) has the molecular formula C8H18ClN2P
and a molecular weight of 208.67 g/mol. Its IUPAC name is 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride.
Molecular Properties
| Compound Name | 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride |
| PubChem CID | 70249249 |
| Molecular Formula | C8H18ClN2P |
| Molecular Weight | 208.67 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride |
| SMILES | CCCCc1cnc(C)[nH]1.Cl.P |
| InChI | InChI=1S/C8H14N2.ClH.H3P/c1-3-4-5-8-6-9-7(2)10-8;;/h6H,3-5H2,1-2H3,(H,9,10);1H;1H3 |
| InChIKey | GRVFEPBZPPNVDZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.67 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride?
The IUPAC name of 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride (CID 70249249) is 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride.
What is the SMILES notation for 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride?
The canonical SMILES for 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride is CCCCc1cnc(C)[nH]1.Cl.P.
What is the InChIKey of 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride?
The InChIKey is GRVFEPBZPPNVDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2.ClH.H3P/c1-3-4-5-8-6-9-7(2)10-8;;/h6H,3-5H2,1-2H3,(H,9,10);1H;1H3.
What are the key properties of 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride?
5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride has a molecular weight of 208.67 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2-methyl-1H-imidazole;phosphane;hydrochloride is sourced from PubChem (CID 70249249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).