C15H27O9P — CID 70249268
[(2R,3R,4S,5S)-7-cyclohexyl-2,3,4,5-tetrahydroxy-6-oxonon-8-enyl] dihydrogen phosphate (PubChem CID 70249268) has the molecular formula C15H27O9P and a molecular weight of 382.35 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-7-cyclohexyl-2,3,4,5-tetrahydroxy-6-oxonon-8-enyl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5S)-7-cyclohexyl-2,3,4,5-tetrahydroxy-6-oxonon-8-enyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 70249268 |
| Molecular Formula | C15H27O9P |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [(2R,3R,4S,5S)-7-cyclohexyl-2,3,4,5-tetrahydroxy-6-oxonon-8-enyl] dihydrogen phosphate |
| SMILES | C=CC(C(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1CCCCC1 |
| InChI | InChI=1S/C15H27O9P/c1-2-10(9-6-4-3-5-7-9)12(17)14(19)15(20)13(18)11(16)8-24-25(21,22)23/h2,9-11,13-16,18-20H,1,3-8H2,(H2,21,22,23)/t10?,11-,13-,14-,15+/m1/s1 |
| InChIKey | PGKMJFFVEIUCHI-TYVYPOSISA-N |
| XLogP | -0.51 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|