C19H20ClN3O2S — CID 70249702
N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-2-[2-(2,2-dimethylbut-3-enyl)-1,3-benzoxazol-5-yl]acetamide (PubChem CID 70249702) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-2-[2-(2,2-dimethylbut-3-enyl)-1,3-benzoxazol-5-yl]acetamide.
| Compound Name | N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-2-[2-(2,2-dimethylbut-3-enyl)-1,3-benzoxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 70249702 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-2-[2-(2,2-dimethylbut-3-enyl)-1,3-benzoxazol-5-yl]acetamide |
| SMILES | C=CC(C)(C)Cc1nc2cc(CC(=O)Nc3snc(C)c3Cl)ccc2o1 |
| InChI | InChI=1S/C19H20ClN3O2S/c1-5-19(3,4)10-16-21-13-8-12(6-7-14(13)25-16)9-15(24)22-18-17(20)11(2)23-26-18/h5-8H,1,9-10H2,2-4H3,(H,22,24) |
| InChIKey | BLLISHFKNLWEFR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|