C10H4Cl4F3NO3 — CID 7025018
N-[(2S)-5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 7025018) has the molecular formula C10H4Cl4F3NO3 and a molecular weight of 384.95 g/mol. Its IUPAC name is N-[(2S)-5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S)-5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 7025018 |
| Molecular Formula | C10H4Cl4F3NO3 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 382.89 |
| IUPAC Name | N-[(2S)-5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@@]1(C(Cl)(Cl)Cl)Oc2ccc(Cl)cc2O1)C(F)(F)F |
| InChI | InChI=1S/C10H4Cl4F3NO3/c11-4-1-2-5-6(3-4)21-10(20-5,9(12,13)14)18-7(19)8(15,16)17/h1-3H,(H,18,19)/t10-/m0/s1 |
| InChIKey | XWVACLCMMRJAEK-JTQLQIEISA-N |
| XLogP | 3.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|