C9H13N3 — CID 70250575
(Z)-N,N'-dimethyl-1-pyridin-3-ylethene-1,2-diamine (PubChem CID 70250575) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is (Z)-N,N'-dimethyl-1-pyridin-3-ylethene-1,2-diamine.
| Compound Name | (Z)-N,N'-dimethyl-1-pyridin-3-ylethene-1,2-diamine |
|---|---|
| PubChem CID | 70250575 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (Z)-N,N'-dimethyl-1-pyridin-3-ylethene-1,2-diamine |
| SMILES | CN/C=C(\NC)c1cccnc1 |
| InChI | InChI=1S/C9H13N3/c1-10-7-9(11-2)8-4-3-5-12-6-8/h3-7,10-11H,1-2H3/b9-7- |
| InChIKey | OLJDXMNYJZELEK-CLFYSBASSA-N |
| XLogP | 0.82 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |