C9H10N2S — CID 70250662
3a,5,6,7-tetrahydro-3H-cyclopenta[f][2,1,3]benzothiadiazole (PubChem CID 70250662) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 3a,5,6,7-tetrahydro-3H-cyclopenta[f][2,1,3]benzothiadiazole.
| Compound Name | 3a,5,6,7-tetrahydro-3H-cyclopenta[f][2,1,3]benzothiadiazole |
|---|---|
| PubChem CID | 70250662 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3a,5,6,7-tetrahydro-3H-cyclopenta[f][2,1,3]benzothiadiazole |
| SMILES | C1=C2CCCC2=CC2NSN=C12 |
| InChI | InChI=1S/C9H10N2S/c1-2-6-4-8-9(11-12-10-8)5-7(6)3-1/h4-5,8,10H,1-3H2 |
| InChIKey | FPGQOLBVUFCEGD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|