C32H39N3O3S2Si — CID 70250784
methyl N-[4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]sulfonyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidothioate (PubChem CID 70250784) has the molecular formula C32H39N3O3S2Si and a molecular weight of 605.90 g/mol. Its IUPAC name is methyl N-[4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]sulfonyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidothioate.
| Compound Name | methyl N-[4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]sulfonyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidothioate |
|---|---|
| PubChem CID | 70250784 |
| Molecular Formula | C32H39N3O3S2Si |
| Molecular Weight | 605.90 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | methyl N-[4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]sulfonyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidothioate |
| SMILES | CSC(=NS(=O)(=O)c1ccc(CCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)cc1)N1CC2(C=N1)CCCC2 |
| InChI | InChI=1S/C32H39N3O3S2Si/c1-31(2,41(38,28-12-6-4-7-13-28)29-14-8-5-9-15-29)23-20-26-16-18-27(19-17-26)40(36,37)34-30(39-3)35-25-32(24-33-35)21-10-11-22-32/h4-9,12-19,24,38H,10-11,20-23,25H2,1-3H3 |
| InChIKey | GIEGOOAQWIQYEO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.90 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|