About methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate
methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate (PubChem CID 70250837) has the molecular formula C21H25NO5
and a molecular weight of 371.43 g/mol. Its IUPAC name is methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate.
Molecular Properties
| Compound Name | methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate |
| PubChem CID | 70250837 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate |
| SMILES | COC(=O)c1cc(OCC2COC(C)(C)O2)cc(-c2ccc(C)cc2N)c1 |
| InChI | InChI=1S/C21H25NO5/c1-13-5-6-18(19(22)7-13)14-8-15(20(23)24-4)10-16(9-14)25-11-17-12-26-21(2,3)27-17/h5-10,17H,11-12,22H2,1-4H3 |
| InChIKey | QFWPRSGXWREJQQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate?
The IUPAC name of methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate (CID 70250837) is methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate.
What is the SMILES notation for methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate?
The canonical SMILES for methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate is COC(=O)c1cc(OCC2COC(C)(C)O2)cc(-c2ccc(C)cc2N)c1.
What is the InChIKey of methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate?
The InChIKey is QFWPRSGXWREJQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO5/c1-13-5-6-18(19(22)7-13)14-8-15(20(23)24-4)10-16(9-14)25-11-17-12-26-21(2,3)27-17/h5-10,17H,11-12,22H2,1-4H3.
What are the key properties of methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate?
methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate has a molecular weight of 371.43 g/mol, XLogP of 3.56, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-amino-4-methylphenyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]benzoate is sourced from PubChem (CID 70250837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).