C10H16N2 — CID 70251029
2-ethyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine (PubChem CID 70251029) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-ethyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine.
| Compound Name | 2-ethyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine |
|---|---|
| PubChem CID | 70251029 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-ethyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine |
| SMILES | CCN1CCC2CC=NC=C2C1 |
| InChI | InChI=1S/C10H16N2/c1-2-12-6-4-9-3-5-11-7-10(9)8-12/h5,7,9H,2-4,6,8H2,1H3 |
| InChIKey | VVUSPIGARNSLCJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |