C21H23NO2 — CID 70251232
methyl 4-(7-methyl-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-c]pyridin-5-yl)benzoate (PubChem CID 70251232) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl 4-(7-methyl-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-c]pyridin-5-yl)benzoate.
| Compound Name | methyl 4-(7-methyl-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-c]pyridin-5-yl)benzoate |
|---|---|
| PubChem CID | 70251232 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | methyl 4-(7-methyl-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-c]pyridin-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2c3cc(C)ccc3C3CNCCC32)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-13-3-8-16-18(11-13)20(17-9-10-22-12-19(16)17)14-4-6-15(7-5-14)21(23)24-2/h3-8,11,17,19-20,22H,9-10,12H2,1-2H3 |
| InChIKey | OJUQBWVOACSVDQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |