C32H39N7O4 — CID 70251500
5-(diaminomethylideneamino)-2-[[2-[8-(naphthalen-1-ylmethyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetyl]amino]pentanoic acid (PubChem CID 70251500) has the molecular formula C32H39N7O4 and a molecular weight of 585.71 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[2-[8-(naphthalen-1-ylmethyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[2-[8-(naphthalen-1-ylmethyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 70251500 |
| Molecular Formula | C32H39N7O4 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[2-[8-(naphthalen-1-ylmethyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)CN1CN(c2ccccc2)C2(CCN(Cc3cccc4ccccc34)CC2)C1=O)C(=O)O |
| InChI | InChI=1S/C32H39N7O4/c33-31(34)35-17-7-14-27(29(41)42)36-28(40)21-38-22-39(25-11-2-1-3-12-25)32(30(38)43)15-18-37(19-16-32)20-24-10-6-9-23-8-4-5-13-26(23)24/h1-6,8-13,27H,7,14-22H2,(H,36,40)(H,41,42)(H4,33,34,35) |
| InChIKey | JYKGKCHERCOEBS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 157.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|