About dipotassium;1-phenylpyrazolidin-3-one;sulfite
dipotassium;1-phenylpyrazolidin-3-one;sulfite (PubChem CID 70251509) has the molecular formula C9H10K2N2O4S
and a molecular weight of 320.45 g/mol. Its IUPAC name is dipotassium;1-phenylpyrazolidin-3-one;sulfite.
Molecular Properties
| Compound Name | dipotassium;1-phenylpyrazolidin-3-one;sulfite |
| PubChem CID | 70251509 |
| Molecular Formula | C9H10K2N2O4S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | dipotassium;1-phenylpyrazolidin-3-one;sulfite |
| SMILES | O=C1CCN(c2ccccc2)N1.O=S([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C9H10N2O.2K.H2O3S/c12-9-6-7-11(10-9)8-4-2-1-3-5-8;;;1-4(2)3/h1-5H,6-7H2,(H,10,12);;;(H2,1,2,3)/q;2*+1;/p-2 |
| InChIKey | JSIKPKDLJDCBHP-UHFFFAOYSA-L |
| XLogP | -6.07 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | -6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;1-phenylpyrazolidin-3-one;sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;1-phenylpyrazolidin-3-one;sulfite?
The IUPAC name of dipotassium;1-phenylpyrazolidin-3-one;sulfite (CID 70251509) is dipotassium;1-phenylpyrazolidin-3-one;sulfite.
What is the SMILES notation for dipotassium;1-phenylpyrazolidin-3-one;sulfite?
The canonical SMILES for dipotassium;1-phenylpyrazolidin-3-one;sulfite is O=C1CCN(c2ccccc2)N1.O=S([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;1-phenylpyrazolidin-3-one;sulfite?
The InChIKey is JSIKPKDLJDCBHP-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H10N2O.2K.H2O3S/c12-9-6-7-11(10-9)8-4-2-1-3-5-8;;;1-4(2)3/h1-5H,6-7H2,(H,10,12);;;(H2,1,2,3)/q;2*+1;/p-2.
What are the key properties of dipotassium;1-phenylpyrazolidin-3-one;sulfite?
dipotassium;1-phenylpyrazolidin-3-one;sulfite has a molecular weight of 320.45 g/mol, XLogP of -6.07, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;1-phenylpyrazolidin-3-one;sulfite is sourced from PubChem (CID 70251509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).