C23H34O5 — CID 70251558
2-[(E)-1-[(2-ethenylcyclohexa-1,3-dien-1-yl)-hydroxymethoxy]pent-1-en-3-yl]oxy-1-[(1S)-4-methoxycyclohex-3-en-1-yl]ethanol (PubChem CID 70251558) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-[(E)-1-[(2-ethenylcyclohexa-1,3-dien-1-yl)-hydroxymethoxy]pent-1-en-3-yl]oxy-1-[(1S)-4-methoxycyclohex-3-en-1-yl]ethanol.
| Compound Name | 2-[(E)-1-[(2-ethenylcyclohexa-1,3-dien-1-yl)-hydroxymethoxy]pent-1-en-3-yl]oxy-1-[(1S)-4-methoxycyclohex-3-en-1-yl]ethanol |
|---|---|
| PubChem CID | 70251558 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-[(E)-1-[(2-ethenylcyclohexa-1,3-dien-1-yl)-hydroxymethoxy]pent-1-en-3-yl]oxy-1-[(1S)-4-methoxycyclohex-3-en-1-yl]ethanol |
| SMILES | C=CC1=C(C(O)O/C=C/C(CC)OCC(O)[C@@H]2CC=C(OC)CC2)CCC=C1 |
| InChI | InChI=1S/C23H34O5/c1-4-17-8-6-7-9-21(17)23(25)27-15-14-19(5-2)28-16-22(24)18-10-12-20(26-3)13-11-18/h4,6,8,12,14-15,18-19,22-25H,1,5,7,9-11,13,16H2,2-3H3/b15-14+/t18-,19?,22?,23?/m1/s1 |
| InChIKey | FKPXIDBRYYMDGX-WRZYZRLNSA-N |
| XLogP | 4.15 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|