C13H19BO7 — CID 70251608
phenyl-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]borinic acid (PubChem CID 70251608) has the molecular formula C13H19BO7 and a molecular weight of 298.10 g/mol. Its IUPAC name is phenyl-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]borinic acid.
| Compound Name | phenyl-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]borinic acid |
|---|---|
| PubChem CID | 70251608 |
| Molecular Formula | C13H19BO7 |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | phenyl-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]borinic acid |
| SMILES | CO[C@H]1O[C@H](COB(O)c2ccccc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19BO7/c1-19-13-12(17)11(16)10(15)9(21-13)7-20-14(18)8-5-3-2-4-6-8/h2-6,9-13,15-18H,7H2,1H3/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | ARIABRZQTPTPFO-LBELIVKGSA-N |
| XLogP | -2.16 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|