About 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene
1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene (PubChem CID 70251776) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene.
Molecular Properties
| Compound Name | 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene |
| PubChem CID | 70251776 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene |
| SMILES | COCC(C)(C)C/C=C/c1cccc(C)c1 |
| InChI | InChI=1S/C15H22O/c1-13-7-5-8-14(11-13)9-6-10-15(2,3)12-16-4/h5-9,11H,10,12H2,1-4H3/b9-6+ |
| InChIKey | XIMBBYIOGGIGHL-RMKNXTFCSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene?
The IUPAC name of 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene (CID 70251776) is 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene.
What is the SMILES notation for 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene?
The canonical SMILES for 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene is COCC(C)(C)C/C=C/c1cccc(C)c1.
What is the InChIKey of 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene?
The InChIKey is XIMBBYIOGGIGHL-RMKNXTFCSA-N. The full InChI is InChI=1S/C15H22O/c1-13-7-5-8-14(11-13)9-6-10-15(2,3)12-16-4/h5-9,11H,10,12H2,1-4H3/b9-6+.
What are the key properties of 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene?
1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene has a molecular weight of 218.34 g/mol, XLogP of 4.07, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-5-methoxy-4,4-dimethylpent-1-enyl]-3-methylbenzene is sourced from PubChem (CID 70251776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).