C28H36F2N6O5 — CID 70251993
tert-butyl N-[8-(2,4-difluorophenyl)-6-[4-methoxy-5-methyl-6-(prop-1-en-2-yloxymethyl)pyrimidin-2-yl]-1-methyl-9-oxo-4,5,7,8-tetrahydro-1,3,6-triazonin-2-yl]carbamate (PubChem CID 70251993) has the molecular formula C28H36F2N6O5 and a molecular weight of 574.63 g/mol. Its IUPAC name is tert-butyl N-[8-(2,4-difluorophenyl)-6-[4-methoxy-5-methyl-6-(prop-1-en-2-yloxymethyl)pyrimidin-2-yl]-1-methyl-9-oxo-4,5,7,8-tetrahydro-1,3,6-triazonin-2-yl]carbamate.
| Compound Name | tert-butyl N-[8-(2,4-difluorophenyl)-6-[4-methoxy-5-methyl-6-(prop-1-en-2-yloxymethyl)pyrimidin-2-yl]-1-methyl-9-oxo-4,5,7,8-tetrahydro-1,3,6-triazonin-2-yl]carbamate |
|---|---|
| PubChem CID | 70251993 |
| Molecular Formula | C28H36F2N6O5 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | tert-butyl N-[8-(2,4-difluorophenyl)-6-[4-methoxy-5-methyl-6-(prop-1-en-2-yloxymethyl)pyrimidin-2-yl]-1-methyl-9-oxo-4,5,7,8-tetrahydro-1,3,6-triazonin-2-yl]carbamate |
| SMILES | C=C(C)OCc1nc(N2CC/N=C(/NC(=O)OC(C)(C)C)N(C)C(=O)C(c3ccc(F)cc3F)C2)nc(OC)c1C |
| InChI | InChI=1S/C28H36F2N6O5/c1-16(2)40-15-22-17(3)23(39-8)33-26(32-22)36-12-11-31-25(34-27(38)41-28(4,5)6)35(7)24(37)20(14-36)19-10-9-18(29)13-21(19)30/h9-10,13,20H,1,11-12,14-15H2,2-8H3,(H,31,34,38) |
| InChIKey | VJDIEMRCSVOLMI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|