C22H41ClOSi2 — CID 70252167
chloro-ethenyl-dimethylsilane;ethenyl-dimethyl-[3-methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-en-2-yl]oxysilane (PubChem CID 70252167) has the molecular formula C22H41ClOSi2 and a molecular weight of 413.19 g/mol. Its IUPAC name is chloro-ethenyl-dimethylsilane;ethenyl-dimethyl-[3-methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-en-2-yl]oxysilane.
| Compound Name | chloro-ethenyl-dimethylsilane;ethenyl-dimethyl-[3-methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 70252167 |
| Molecular Formula | C22H41ClOSi2 |
| Molecular Weight | 413.19 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | chloro-ethenyl-dimethylsilane;ethenyl-dimethyl-[3-methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-en-2-yl]oxysilane |
| SMILES | C=C[Si](C)(C)Cl.C=C[Si](C)(C)OC(C)C(C)C=CC1CC=C(C)C1(C)C |
| InChI | InChI=1S/C18H32OSi.C4H9ClSi/c1-9-20(7,8)19-16(4)14(2)10-12-17-13-11-15(3)18(17,5)6;1-4-6(2,3)5/h9-12,14,16-17H,1,13H2,2-8H3;4H,1H2,2-3H3 |
| InChIKey | WFQIKYZQILJYPL-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.19 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|