C8H19CuN3 — CID 70252551
copper;1,4-dimethyltriazonane (PubChem CID 70252551) has the molecular formula C8H19CuN3 and a molecular weight of 220.81 g/mol. Its IUPAC name is copper;1,4-dimethyltriazonane.
| Compound Name | copper;1,4-dimethyltriazonane |
|---|---|
| PubChem CID | 70252551 |
| Molecular Formula | C8H19CuN3 |
| Molecular Weight | 220.81 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | copper;1,4-dimethyltriazonane |
| SMILES | CC1CCCCCN(C)NN1.[Cu] |
| InChI | InChI=1S/C8H19N3.Cu/c1-8-6-4-3-5-7-11(2)10-9-8;/h8-10H,3-7H2,1-2H3; |
| InChIKey | SEDXICSLAJKUAS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.81 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |