About 5-(4-iodophenyl)-2,2-dimethylfuran-3-one
5-(4-iodophenyl)-2,2-dimethylfuran-3-one (PubChem CID 70252624) has the molecular formula C12H11IO2
and a molecular weight of 314.12 g/mol. Its IUPAC name is 5-(4-iodophenyl)-2,2-dimethylfuran-3-one.
Molecular Properties
| Compound Name | 5-(4-iodophenyl)-2,2-dimethylfuran-3-one |
| PubChem CID | 70252624 |
| Molecular Formula | C12H11IO2 |
| Molecular Weight | 314.12 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 5-(4-iodophenyl)-2,2-dimethylfuran-3-one |
| SMILES | CC1(C)OC(c2ccc(I)cc2)=CC1=O |
| InChI | InChI=1S/C12H11IO2/c1-12(2)11(14)7-10(15-12)8-3-5-9(13)6-4-8/h3-7H,1-2H3 |
| InChIKey | OVNGJCLKZMRJFL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-iodophenyl)-2,2-dimethylfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-iodophenyl)-2,2-dimethylfuran-3-one?
The IUPAC name of 5-(4-iodophenyl)-2,2-dimethylfuran-3-one (CID 70252624) is 5-(4-iodophenyl)-2,2-dimethylfuran-3-one.
What is the SMILES notation for 5-(4-iodophenyl)-2,2-dimethylfuran-3-one?
The canonical SMILES for 5-(4-iodophenyl)-2,2-dimethylfuran-3-one is CC1(C)OC(c2ccc(I)cc2)=CC1=O.
What is the InChIKey of 5-(4-iodophenyl)-2,2-dimethylfuran-3-one?
The InChIKey is OVNGJCLKZMRJFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11IO2/c1-12(2)11(14)7-10(15-12)8-3-5-9(13)6-4-8/h3-7H,1-2H3.
What are the key properties of 5-(4-iodophenyl)-2,2-dimethylfuran-3-one?
5-(4-iodophenyl)-2,2-dimethylfuran-3-one has a molecular weight of 314.12 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-iodophenyl)-2,2-dimethylfuran-3-one is sourced from PubChem (CID 70252624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).