About 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine
2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine (PubChem CID 70252666) has the molecular formula C8H12F3N3
and a molecular weight of 207.20 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine.
Molecular Properties
| Compound Name | 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine |
| PubChem CID | 70252666 |
| Molecular Formula | C8H12F3N3 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine |
| SMILES | CC(C)(N)C1=CC=NC(C(F)(F)F)N1 |
| InChI | InChI=1S/C8H12F3N3/c1-7(2,12)5-3-4-13-6(14-5)8(9,10)11/h3-4,6,14H,12H2,1-2H3 |
| InChIKey | GPABHFXYOFTWFD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine?
The IUPAC name of 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine (CID 70252666) is 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine.
What is the SMILES notation for 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine?
The canonical SMILES for 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine is CC(C)(N)C1=CC=NC(C(F)(F)F)N1.
What is the InChIKey of 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine?
The InChIKey is GPABHFXYOFTWFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3N3/c1-7(2,12)5-3-4-13-6(14-5)8(9,10)11/h3-4,6,14H,12H2,1-2H3.
What are the key properties of 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine?
2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine has a molecular weight of 207.20 g/mol, XLogP of 1.17, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(trifluoromethyl)-1,2-dihydropyrimidin-6-yl]propan-2-amine is sourced from PubChem (CID 70252666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).