About 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate
3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate (PubChem CID 70252774) has the molecular formula C18H25N3O4
and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate |
| PubChem CID | 70252774 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate |
| SMILES | COC(=O)C1(c2ccccc2)CN(C(=O)OC(C)(C)CCCN)C=N1 |
| InChI | InChI=1S/C18H25N3O4/c1-17(2,10-7-11-19)25-16(23)21-12-18(20-13-21,15(22)24-3)14-8-5-4-6-9-14/h4-6,8-9,13H,7,10-12,19H2,1-3H3 |
| InChIKey | QFAJIWAUBZHHGE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate?
The IUPAC name of 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate (CID 70252774) is 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate.
What is the SMILES notation for 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate?
The canonical SMILES for 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate is COC(=O)C1(c2ccccc2)CN(C(=O)OC(C)(C)CCCN)C=N1.
What is the InChIKey of 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate?
The InChIKey is QFAJIWAUBZHHGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O4/c1-17(2,10-7-11-19)25-16(23)21-12-18(20-13-21,15(22)24-3)14-8-5-4-6-9-14/h4-6,8-9,13H,7,10-12,19H2,1-3H3.
What are the key properties of 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate?
3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate has a molecular weight of 347.42 g/mol, XLogP of 2.05, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-(5-amino-2-methylpentan-2-yl) 5-O-methyl 5-phenyl-4H-imidazole-3,5-dicarboxylate is sourced from PubChem (CID 70252774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).