About 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine
1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine (PubChem CID 70253087) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine |
| PubChem CID | 70253087 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)C(C)c1cccc2cc(C)c(C)nc12 |
| InChI | InChI=1S/C17H24N2/c1-6-19(7-2)14(5)16-10-8-9-15-11-12(3)13(4)18-17(15)16/h8-11,14H,6-7H2,1-5H3 |
| InChIKey | SJLBKSQXMGGPGP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine?
The IUPAC name of 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine (CID 70253087) is 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine.
What is the SMILES notation for 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine?
The canonical SMILES for 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine is CCN(CC)C(C)c1cccc2cc(C)c(C)nc12.
What is the InChIKey of 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine?
The InChIKey is SJLBKSQXMGGPGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2/c1-6-19(7-2)14(5)16-10-8-9-15-11-12(3)13(4)18-17(15)16/h8-11,14H,6-7H2,1-5H3.
What are the key properties of 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine?
1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine has a molecular weight of 256.39 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethylquinolin-8-yl)-N,N-diethylethanamine is sourced from PubChem (CID 70253087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).